Products 1009376-82-2
CAS 1009376-82-2 is the registry number for Methyl (3R,6S)-6-methylpiperidine-3-carboxylate acetyl-D-leucinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-acetamido-4-methylpentanoic acid;methyl (3R,6S)-6-methylpiperidine-3-carboxylate (CAS 1009376-82-2) is a chemical compound with the molecular formula C16H30N2O5 and a molecular weight of 330.42 g/mol. IUPAC name: (2R)-2-acetamido-4-methylpentanoic acid;methyl (3R,6S)-6-methylpiperidine-3-carboxylate. InChIKey: UAIQUTMXOXNFNV-DEECILGISA-N.
| Molecular formula | C16H30N2O5 |
|---|---|
| Molecular weight | 330.42 g/mol |
| IUPAC name | (2R)-2-acetamido-4-methylpentanoic acid;methyl (3R,6S)-6-methylpiperidine-3-carboxylate |
| InChIKey | UAIQUTMXOXNFNV-DEECILGISA-N |
| SMILES | C[C@H]1CC[C@H](CN1)C(=O)OC.CC(C)C[C@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)