CAS 2224423-03-2 appears in our catalog under these names: Di-tert-butyl (R)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate, 98%, Di-tert-butyl (R)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
Ditert-butyl (2R)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate (CAS 2224423-03-2) is a chemical compound with the molecular formula C16H30N2O5 and a molecular weight of 330.42 g/mol. IUPAC name: ditert-butyl (2R)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate. InChIKey: VUZKEHBQEOADAS-GFCCVEGCSA-N.
| Molecular formula | C16H30N2O5 |
|---|---|
| Molecular weight | 330.42 g/mol |
| IUPAC name | ditert-butyl (2R)-2-(2-hydroxyethyl)piperazine-1,4-dicarboxylate |
| InChIKey | VUZKEHBQEOADAS-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CCO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)