Products 2561529-04-0
CAS 2561529-04-0 is the registry number for ditert-butyl (2R)-2-(methoxymethyl)piperazine-1,4-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ditert-butyl (2R)-2-(methoxymethyl)piperazine-1,4-dicarboxylate (CAS 2561529-04-0) is a chemical compound with the molecular formula C16H30N2O5 and a molecular weight of 330.42 g/mol. IUPAC name: ditert-butyl (2R)-2-(methoxymethyl)piperazine-1,4-dicarboxylate. InChIKey: QVUIGEKXFTYVDT-GFCCVEGCSA-N.
| Molecular formula | C16H30N2O5 |
|---|---|
| Molecular weight | 330.42 g/mol |
| IUPAC name | ditert-butyl (2R)-2-(methoxymethyl)piperazine-1,4-dicarboxylate |
| InChIKey | QVUIGEKXFTYVDT-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)COC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)