CAS 1427561-80-5 appears in our catalog under these names: Di-tert-butyl (2r,5r)-2-(hydroxymethyl)-5-methylpiperazine-1,4-dicarboxylate, 95%, di-tert-butyl (2R,5R)-2-(hydroxymethyl)-5-methylpiperazine-1,4-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Ditert-butyl (2R,5R)-2-(hydroxymethyl)-5-methylpiperazine-1,4-dicarboxylate (CAS 1427561-80-5) is a chemical compound with the molecular formula C16H30N2O5 and a molecular weight of 330.42 g/mol. IUPAC name: ditert-butyl (2R,5R)-2-(hydroxymethyl)-5-methylpiperazine-1,4-dicarboxylate. InChIKey: HZKVRPTUZKGZOX-VXGBXAGGSA-N.
| Molecular formula | C16H30N2O5 |
|---|---|
| Molecular weight | 330.42 g/mol |
| IUPAC name | ditert-butyl (2R,5R)-2-(hydroxymethyl)-5-methylpiperazine-1,4-dicarboxylate |
| InChIKey | HZKVRPTUZKGZOX-VXGBXAGGSA-N |
| SMILES | C[C@@H]1CN([C@H](CN1C(=O)OC(C)(C)C)CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)