CAS 1009378-85-1 is the registry number for 3,7-Dihydro-1H-purine-2,6-dione-8-13C. Offered by: TRC. Available pack sizes: 5mg.
3,7-dihydropurine-2,6-dione (CAS 1009378-85-1) is a chemical compound with the molecular formula C5H4N4O2 and a molecular weight of 153.10 g/mol. IUPAC name: 3,7-dihydropurine-2,6-dione. InChIKey: LRFVTYWOQMYALW-OUBTZVSYSA-N.
| Molecular formula | C5H4N4O2 |
|---|---|
| Molecular weight | 153.10 g/mol |
| IUPAC name | 3,7-dihydropurine-2,6-dione |
| InChIKey | LRFVTYWOQMYALW-OUBTZVSYSA-N |
| SMILES | [13CH]1=NC2=C(N1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)