CAS 100953-84-2 appears in our catalog under these names: 1,3-Bis(4-cyanophenyl)urea, 95%, 1,3-Bis(4-cyanophenyl)urea 97%, 1,3-Bis(4-cyanophenyl)urea, 97%, 97%, 1,3-BIS(4-CYANOPHENYL)UREA, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
1,3-bis(4-cyanophenyl)urea (CAS 100953-84-2) is a chemical compound with the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. IUPAC name: 1,3-bis(4-cyanophenyl)urea. InChIKey: XUOGYSFAFGNJST-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O |
|---|---|
| Molecular weight | 262.27 g/mol |
| IUPAC name | 1,3-bis(4-cyanophenyl)urea |
| InChIKey | XUOGYSFAFGNJST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)NC(=O)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)