CAS 1020252-28-1 appears in our catalog under these names: 4-(3-Phenoxyphenyl)-1H-1,2,3-triazole-5-carbonitrile, 4-(3-Phenoxyphenyl)-1H-1,2,3-triazole-5-carbonitrile, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5000mg, 10g.
5-(3-phenoxyphenyl)-2H-triazole-4-carbonitrile (CAS 1020252-28-1) is a chemical compound with the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. IUPAC name: 5-(3-phenoxyphenyl)-2H-triazole-4-carbonitrile. InChIKey: NXOAIXQCQZIYEF-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O |
|---|---|
| Molecular weight | 262.27 g/mol |
| IUPAC name | 5-(3-phenoxyphenyl)-2H-triazole-4-carbonitrile |
| InChIKey | NXOAIXQCQZIYEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C3=NNN=C3C#N |
Computed by PubChem (NCBI)