CAS 586959-21-9 is the registry number for (1H-Benzo(d)(1,2,3)triazol-1-yl)(1H-indol-2-yl)methanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Benzotriazol-1-yl(1H-indol-2-yl)methanone (CAS 586959-21-9) is a chemical compound with the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. IUPAC name: benzotriazol-1-yl(1H-indol-2-yl)methanone. InChIKey: LRWWEKWNESRKJV-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O |
|---|---|
| Molecular weight | 262.27 g/mol |
| IUPAC name | benzotriazol-1-yl(1H-indol-2-yl)methanone |
| InChIKey | LRWWEKWNESRKJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)N3C4=CC=CC=C4N=N3 |
Computed by PubChem (NCBI)