CAS 139339-02-9 is the registry number for KF-17625. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-phenyl-3H-imidazo[4,5-c][1,8]naphthyridin-4-one (CAS 139339-02-9) is a chemical compound with the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. IUPAC name: 5-phenyl-3H-imidazo[4,5-c][1,8]naphthyridin-4-one. InChIKey: NDDBRRFHXNPOLY-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O |
|---|---|
| Molecular weight | 262.27 g/mol |
| IUPAC name | 5-phenyl-3H-imidazo[4,5-c][1,8]naphthyridin-4-one |
| InChIKey | NDDBRRFHXNPOLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=CC=N3)C4=C(C2=O)NC=N4 |
Computed by PubChem (NCBI)