Products 100973-03-3

CAS 100973-03-3 is the registry number for 2,5-Dipropoxyterephthalic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,5-dipropoxyterephthalic acid (CAS 100973-03-3) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: 2,5-dipropoxyterephthalic acid. InChIKey: PZYPRFXWTAKZNU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O6
Molecular weight282.29 g/mol
IUPAC name2,5-dipropoxyterephthalic acid
InChIKeyPZYPRFXWTAKZNU-UHFFFAOYSA-N
SMILESCCCOC1=CC(=C(C=C1C(=O)O)OCCC)C(=O)O

Computed by PubChem (NCBI)