Products 78647-52-6

CAS 78647-52-6 is the registry number for 3-(3,4-Dimethoxybenzyl)-4-methoxy-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-4-oxobutanoic acid (CAS 78647-52-6) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: 3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-4-oxobutanoic acid. InChIKey: DPKYOILHCYHSCU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O6
Molecular weight282.29 g/mol
IUPAC name3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-4-oxobutanoic acid
InChIKeyDPKYOILHCYHSCU-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CC(CC(=O)O)C(=O)OC)OC

Computed by PubChem (NCBI)