Products 101004-93-7

CAS 101004-93-7 is the registry number for 3-Methyl-2-(1-oxo-1,3-dihydro-2h-isoindol-2-yl)butanoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid (CAS 101004-93-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid. InChIKey: JULAETYRRYJIAR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO3
Molecular weight233.26 g/mol
IUPAC name3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid
InChIKeyJULAETYRRYJIAR-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)N1CC2=CC=CC=C2C1=O

Computed by PubChem (NCBI)