CAS 298700-69-3 appears in our catalog under these names: (2R)-3-Methyl-2-(1-oxo-2,3-dihydro-1h-isoindol-2-yl)butanoic acid, 95%, (2R)-3-Methyl-2-(1-oxo-2,3-dihydro-1H-isoindol-2-yl)butanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.
(2R)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid (CAS 298700-69-3) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (2R)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid. InChIKey: JULAETYRRYJIAR-LLVKDONJSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2R)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid |
| InChIKey | JULAETYRRYJIAR-LLVKDONJSA-N |
| SMILES | CC(C)[C@H](C(=O)O)N1CC2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)