CAS 180923-77-7 appears in our catalog under these names: (2S)-3-Methyl-2-(1-oxo-2,3-dihydro-1h-isoindol-2-yl)butanoic acid, 98%, (2S)–3–Methyl–2–(1–oxo–2,3–dihydro–1H–isoindol–2–yl)butanoic acid, (S)-3-Methyl-2-(1-oxoisoindolin-2-yl)butanoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 2,5g.
(2S)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid (CAS 180923-77-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (2S)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid. InChIKey: JULAETYRRYJIAR-NSHDSACASA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2S)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid |
| InChIKey | JULAETYRRYJIAR-NSHDSACASA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N1CC2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)