Products 1010863-54-3

CAS 1010863-54-3 is the registry number for Ethyl 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylate (CAS 1010863-54-3) is a chemical compound with the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. IUPAC name: ethyl 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylate. InChIKey: PCEDSNDHNRHRTL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15N3O4S
Molecular weight273.31 g/mol
IUPAC nameethyl 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylate
InChIKeyPCEDSNDHNRHRTL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(N=C1)C2CCS(=O)(=O)C2)N

Computed by PubChem (NCBI)