Products 1286648-18-7
CAS 1286648-18-7 is the registry number for 2-(Butylamino)-5-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(butylamino)-5-nitrobenzenesulfonamide (CAS 1286648-18-7) is a chemical compound with the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. IUPAC name: 2-(butylamino)-5-nitrobenzenesulfonamide. InChIKey: KPNMAMJCPBXHMC-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 2-(butylamino)-5-nitrobenzenesulfonamide |
| InChIKey | KPNMAMJCPBXHMC-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)