Products 117082-97-0
CAS 117082-97-0 is the registry number for N-(2-(Dimethylamino)ethyl)-3-nitrobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide (CAS 117082-97-0) is a chemical compound with the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. IUPAC name: N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide. InChIKey: QITKYWWYSBNNIM-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
| InChIKey | QITKYWWYSBNNIM-UHFFFAOYSA-N |
| SMILES | CN(C)CCNS(=O)(=O)C1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)