Products 81676-66-6
CAS 81676-66-6 appears in our catalog under these names: 4-(Dimethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide, 98%, Benzenesulfonamide, 4-(dimethylamino)-N,N-dimethyl-3-nitro-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-(dimethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide (CAS 81676-66-6) is a chemical compound with the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. IUPAC name: 4-(dimethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide. InChIKey: RTMPGTFARXUPKX-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 4-(dimethylamino)-N,N-dimethyl-3-nitrobenzenesulfonamide |
| InChIKey | RTMPGTFARXUPKX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)S(=O)(=O)N(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)