Products 1010924-54-5

CAS 1010924-54-5 is the registry number for [4-(8-Methoxy-2-oxo-2h-chromen-3-yl)phenoxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetic acid (CAS 1010924-54-5) is a chemical compound with the molecular formula C18H14O6 and a molecular weight of 326.3 g/mol. IUPAC name: 2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetic acid. InChIKey: BPENHAICJUFLDS-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O6
Molecular weight326.3 g/mol
IUPAC name2-[4-(8-methoxy-2-oxochromen-3-yl)phenoxy]acetic acid
InChIKeyBPENHAICJUFLDS-UHFFFAOYSA-N
SMILESCOC1=CC=CC2=C1OC(=O)C(=C2)C3=CC=C(C=C3)OCC(=O)O

Computed by PubChem (NCBI)