CAS 50875-24-6 is the registry number for Toxyloxanthone B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one (CAS 50875-24-6) is a chemical compound with the molecular formula C18H14O6 and a molecular weight of 326.3 g/mol. IUPAC name: 5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one. InChIKey: MFKYNKVEQUTJEH-UHFFFAOYSA-N.
| Molecular formula | C18H14O6 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one |
| InChIKey | MFKYNKVEQUTJEH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=CC3=C2C(=O)C4=C(C=C(C=C4O3)O)O)O)C |
Computed by PubChem (NCBI)