Products 50597-93-8
CAS 50597-93-8 appears in our catalog under these names: Isojacareubin, Isojacareubin, 98.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 5 mg, 1 mg.
6,10,11-trihydroxy-3,3-dimethylpyrano[2,3-c]xanthen-7-one (CAS 50597-93-8) is a chemical compound with the molecular formula C18H14O6 and a molecular weight of 326.3 g/mol. IUPAC name: 6,10,11-trihydroxy-3,3-dimethylpyrano[2,3-c]xanthen-7-one. InChIKey: FSTNFJKGRSHPBO-UHFFFAOYSA-N.
| Molecular formula | C18H14O6 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 6,10,11-trihydroxy-3,3-dimethylpyrano[2,3-c]xanthen-7-one |
| InChIKey | FSTNFJKGRSHPBO-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)C=CC(=C4O)O)O)C |
Computed by PubChem (NCBI)