CAS 66553-02-4 appears in our catalog under these names: Dimethyl 4,4’-Oxalyldibenzoate, 97%, 97%, Dimethyl 4,4'-oxalyldibenzoate, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g.
Methyl 4-[2-(4-methoxycarbonylphenyl)-2-oxoacetyl]benzoate (CAS 66553-02-4) is a chemical compound with the molecular formula C18H14O6 and a molecular weight of 326.3 g/mol. IUPAC name: methyl 4-[2-(4-methoxycarbonylphenyl)-2-oxoacetyl]benzoate. InChIKey: PCLYIKBMKKHYMD-UHFFFAOYSA-N.
| Molecular formula | C18H14O6 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | methyl 4-[2-(4-methoxycarbonylphenyl)-2-oxoacetyl]benzoate |
| InChIKey | PCLYIKBMKKHYMD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)