CAS 101132-73-4 is the registry number for 2-(Amino-15N)-5-methyl-benzenesulfonic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(15N)azanyl-5-methylbenzenesulfonic acid (CAS 101132-73-4) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 188.21 g/mol. IUPAC name: 2-(15N)azanyl-5-methylbenzenesulfonic acid. InChIKey: LTPSRQRIPCVMKQ-VJJZLTLGSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 2-(15N)azanyl-5-methylbenzenesulfonic acid |
| InChIKey | LTPSRQRIPCVMKQ-VJJZLTLGSA-N |
| SMILES | CC1=CC(=C(C=C1)[15NH2])S(=O)(=O)O |
Computed by PubChem (NCBI)