Products 88-44-8
CAS 88-44-8 appears in our catalog under these names: 4-Aminotoluene-3-sulfonic acid, 2-Amino-5-methylbenzenesulfonic acid, 99% , p-Toluidine-2-sulfonic Acid, >98.0%(HPLC)(T), 4-Aminotoluene-3-sulfonic acid 98%, 4-AMINOTOLUENE-3-SULFONIC ACID, 99% (2-&. Offered by: Dr. Ehrenstorfer, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 50g, 250g, 2,5g, 0,25g, 25g, 500g, 100g.
2-amino-5-methylbenzenesulfonic acid (CAS 88-44-8) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: 2-amino-5-methylbenzenesulfonic acid. InChIKey: LTPSRQRIPCVMKQ-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 2-amino-5-methylbenzenesulfonic acid |
| InChIKey | LTPSRQRIPCVMKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)S(=O)(=O)O |
Computed by PubChem (NCBI)