CAS 1011478-57-1 appears in our catalog under these names: (S)-Methyl 2-amino-3-hydroxy-3-methylbutanoate hydrochloride, 95%, 95%, (S)-METHYL 2-AMINO-3-HYDROXY-3-METHYLBUTANOATE HCL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl (2S)-2-amino-3-hydroxy-3-methylbutanoate;hydrochloride (CAS 1011478-57-1) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: methyl (2S)-2-amino-3-hydroxy-3-methylbutanoate;hydrochloride. InChIKey: FOAAHTSYWGRARN-PGMHMLKASA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-hydroxy-3-methylbutanoate;hydrochloride |
| InChIKey | FOAAHTSYWGRARN-PGMHMLKASA-N |
| SMILES | CC(C)([C@@H](C(=O)OC)N)O.Cl |
Computed by PubChem (NCBI)