CAS 1416445-08-3 appears in our catalog under these names: (R)-Methyl 2-amino-3-hydroxy-3-methylbutanoate hydrochloride, 95%, (R)-Methyl 2-amino-3-hydroxy-3-methylbutanoate hydrochloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 5g, 100mg, 1g.
Methyl (2R)-2-amino-3-hydroxy-3-methylbutanoate;hydrochloride (CAS 1416445-08-3) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: methyl (2R)-2-amino-3-hydroxy-3-methylbutanoate;hydrochloride. InChIKey: FOAAHTSYWGRARN-WCCKRBBISA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-hydroxy-3-methylbutanoate;hydrochloride |
| InChIKey | FOAAHTSYWGRARN-WCCKRBBISA-N |
| SMILES | CC(C)([C@H](C(=O)OC)N)O.Cl |
Computed by PubChem (NCBI)