CAS 1011582-94-7 is the registry number for N-(3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)isobutyramide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide (CAS 1011582-94-7) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide. InChIKey: GCLASFIAVTZIQC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
| InChIKey | GCLASFIAVTZIQC-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC2=C(C=C1)OCC(=O)N2 |
Computed by PubChem (NCBI)