CAS 1011736-08-5 is the registry number for N-Nitroso Tolazoline. Offered by: TRC. Available pack sizes: 250mg.
2-benzyl-1-nitroso-4,5-dihydroimidazole (CAS 1011736-08-5) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 2-benzyl-1-nitroso-4,5-dihydroimidazole. InChIKey: CJRYRCFEHPNLLM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-benzyl-1-nitroso-4,5-dihydroimidazole |
| InChIKey | CJRYRCFEHPNLLM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=N1)CC2=CC=CC=C2)N=O |
Computed by PubChem (NCBI)