CAS 101183-99-7 is the registry number for CK-2289. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-ethyl-5-(4-imidazol-1-ylbenzoyl)-1,3-dihydroimidazol-2-one (CAS 101183-99-7) is a chemical compound with the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. IUPAC name: 4-ethyl-5-(4-imidazol-1-ylbenzoyl)-1,3-dihydroimidazol-2-one. InChIKey: FIYSLYBKJKWZMC-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O2 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | 4-ethyl-5-(4-imidazol-1-ylbenzoyl)-1,3-dihydroimidazol-2-one |
| InChIKey | FIYSLYBKJKWZMC-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=O)N1)C(=O)C2=CC=C(C=C2)N3C=CN=C3 |
Computed by PubChem (NCBI)