CAS 1012-05-1 appears in our catalog under these names: Lisinopril EP Impurity A, DL-Homophenylalanine, >95% (HPLC), (2RS)-2-Amino-4-phenylbutanoic Acid, H–DL–Homophe–OH, DL-Homophenylalanine, >97.0%(HPLC)(T). Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 1g, 250mg, 5g, 25mg, 100mg, 25g, 10g.
2-amino-4-phenylbutanoic acid (CAS 1012-05-1) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-amino-4-phenylbutanoic acid. InChIKey: JTTHKOPSMAVJFE-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-amino-4-phenylbutanoic acid |
| InChIKey | JTTHKOPSMAVJFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C(=O)O)N |
Computed by PubChem (NCBI)