CAS 82795-51-5 appears in our catalog under these names: D-Homophenylalanine, >95% (HPLC), H–D–HoPhe–OH, H-D-HPhe-OH, D-Homophenylalanine, 98% , D-Homophenylalanine, >98.0%(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 25g, 5g, 100g, 1g, 10g, 500g.
(2R)-2-amino-4-phenylbutanoic acid (CAS 82795-51-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2R)-2-amino-4-phenylbutanoic acid. InChIKey: JTTHKOPSMAVJFE-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2R)-2-amino-4-phenylbutanoic acid |
| InChIKey | JTTHKOPSMAVJFE-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)