CAS 1012081-58-1 appears in our catalog under these names: 4-(Diethoxymethyl)-1-NP-triazole, 4-(Diethoxymethyl)-1-(4-nitrophenyl)-1H-1,2,3-triazole, 4-(Diethoxymethyl)-1-(4-nitrophenyl)-1H-1,2,3-triazole, 95%. Offered by: Iris Biotech, Biosynth, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
4-(diethoxymethyl)-1-(4-nitrophenyl)triazole (CAS 1012081-58-1) is a chemical compound with the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. IUPAC name: 4-(diethoxymethyl)-1-(4-nitrophenyl)triazole. InChIKey: FULOCKNLBZSRLZ-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O4 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 4-(diethoxymethyl)-1-(4-nitrophenyl)triazole |
| InChIKey | FULOCKNLBZSRLZ-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CN(N=N1)C2=CC=C(C=C2)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)