Products 2305668-24-8
CAS 2305668-24-8 is the registry number for 1,1'-Methylenebis(3,5-dimethyl-1H-pyrazole-4-carboxylic acid), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[(4-carboxy-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole-4-carboxylic acid (CAS 2305668-24-8) is a chemical compound with the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. IUPAC name: 1-[(4-carboxy-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: LJBYUOGIXRVINA-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O4 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 1-[(4-carboxy-3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | LJBYUOGIXRVINA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CN2C(=C(C(=N2)C)C(=O)O)C)C)C(=O)O |
Computed by PubChem (NCBI)