Products 1155610-22-2
CAS 1155610-22-2 appears in our catalog under these names: N-((3,4-Dimethoxyphenyl)methyl)-1-methyl-4-nitro-1H-imidazol-5-amine, 95%, N-((3,4-Dimethoxyphenyl)methyl)-1-methyl-4-nitro-1H-imidazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-5-nitroimidazol-4-amine (CAS 1155610-22-2) is a chemical compound with the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-5-nitroimidazol-4-amine. InChIKey: IOOKGUAUJMXMKS-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O4 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-5-nitroimidazol-4-amine |
| InChIKey | IOOKGUAUJMXMKS-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1NCC2=CC(=C(C=C2)OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)