CAS 612838-45-6 is the registry number for tert-Butyl N-(4-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[4-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenyl]carbamate (CAS 612838-45-6) is a chemical compound with the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. IUPAC name: tert-butyl N-[4-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenyl]carbamate. InChIKey: IBCHBLCQVBQVQH-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O4 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | tert-butyl N-[4-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenyl]carbamate |
| InChIKey | IBCHBLCQVBQVQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)N2C(=O)NNC2=O |
Computed by PubChem (NCBI)