CAS 5037-75-2 appears in our catalog under these names: Cyclo(Phe-Gly), 3-Benzylpiperazine-2,5-dione, Cyclo(Phe-Gly), 98%, 3-Benzylpiperazine-2,5-dione, 98%, 98%, Cyclo(Phe-Gly), 99.94%. Offered by: Chemat Brand, TRC, AmBeed, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 250mg, 50mg, 5g, 1g, 10mM/1mL, 5 mg.
3-benzylpiperazine-2,5-dione (CAS 5037-75-2) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-benzylpiperazine-2,5-dione. InChIKey: UZOJHXFWJFSFAI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-benzylpiperazine-2,5-dione |
| InChIKey | UZOJHXFWJFSFAI-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(C(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)