CAS 101251-33-6 is the registry number for 3-Amino-4,5-dimethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-amino-4,5-dimethylbenzenesulfonamide (CAS 101251-33-6) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 3-amino-4,5-dimethylbenzenesulfonamide. InChIKey: YXQMLWCILAYJQY-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 3-amino-4,5-dimethylbenzenesulfonamide |
| InChIKey | YXQMLWCILAYJQY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)N)S(=O)(=O)N |
Computed by PubChem (NCBI)