CAS 101259-10-3 appears in our catalog under these names: 4–Amino–2–hydroxy–3–methoxybenzoic acid, 4-Amino-2-hydroxy-3-methoxybenzoic acid 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-amino-2-hydroxy-3-methoxybenzoic acid (CAS 101259-10-3) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 4-amino-2-hydroxy-3-methoxybenzoic acid. InChIKey: AYSVPTXKRHVQAE-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 4-amino-2-hydroxy-3-methoxybenzoic acid |
| InChIKey | AYSVPTXKRHVQAE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1O)C(=O)O)N |
Computed by PubChem (NCBI)