CAS 101268-22-8 is the registry number for 1-(4-Toluenesulphonyl)-3,3-dimethylbutane-2-one. Offered by: Biosynth. Available pack sizes: 250g.
3,3-dimethyl-1-(4-methylphenyl)sulfonylbutan-2-one (CAS 101268-22-8) is a chemical compound with the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. IUPAC name: 3,3-dimethyl-1-(4-methylphenyl)sulfonylbutan-2-one. InChIKey: HQISUXUFXCVRIR-UHFFFAOYSA-N.
| Molecular formula | C13H18O3S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 3,3-dimethyl-1-(4-methylphenyl)sulfonylbutan-2-one |
| InChIKey | HQISUXUFXCVRIR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)C(C)(C)C |
Computed by PubChem (NCBI)