Products 78300-37-5

CAS 78300-37-5 is the registry number for 3-Cyclopropylpropyl 4-methylbenzenesulfonate 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-cyclopropylpropyl 4-methylbenzenesulfonate (CAS 78300-37-5) is a chemical compound with the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. IUPAC name: 3-cyclopropylpropyl 4-methylbenzenesulfonate. InChIKey: VDSYQACFSNGUMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3S
Molecular weight254.35 g/mol
IUPAC name3-cyclopropylpropyl 4-methylbenzenesulfonate
InChIKeyVDSYQACFSNGUMQ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCCC2CC2

Computed by PubChem (NCBI)