CAS 698379-75-8 is the registry number for 2,3-Dimethyl-3-buten-1-ol-1-(4-methylbenzenesulfonate). Offered by: TRC. Available pack sizes: 1g.
2,3-dimethylbut-3-enyl 4-methylbenzenesulfonate (CAS 698379-75-8) is a chemical compound with the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. IUPAC name: 2,3-dimethylbut-3-enyl 4-methylbenzenesulfonate. InChIKey: VMTWHHGXHNEEKF-UHFFFAOYSA-N.
| Molecular formula | C13H18O3S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 2,3-dimethylbut-3-enyl 4-methylbenzenesulfonate |
| InChIKey | VMTWHHGXHNEEKF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)C(=C)C |
Computed by PubChem (NCBI)