CAS 34019-85-7 is the registry number for (3Z)-1-(4-Methylbenzenesulfonate) 3-Hexen-1-ol. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
[(E)-hex-3-enyl] 4-methylbenzenesulfonate (CAS 34019-85-7) is a chemical compound with the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. IUPAC name: [(E)-hex-3-enyl] 4-methylbenzenesulfonate. InChIKey: PTCRTTULASBLSJ-SNAWJCMRSA-N.
| Molecular formula | C13H18O3S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | [(E)-hex-3-enyl] 4-methylbenzenesulfonate |
| InChIKey | PTCRTTULASBLSJ-SNAWJCMRSA-N |
| SMILES | CC/C=C/CCOS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)