CAS 10131-14-3 is the registry number for Methyl 5,6-dihydroxy-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5,6-dihydroxy-1H-indole-2-carboxylate (CAS 10131-14-3) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 5,6-dihydroxy-1H-indole-2-carboxylate. InChIKey: LMQPTBZVHDIVKT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 5,6-dihydroxy-1H-indole-2-carboxylate |
| InChIKey | LMQPTBZVHDIVKT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=C(C=C2N1)O)O |
Computed by PubChem (NCBI)