CAS 1013330-79-4 is the registry number for N-((4-(((4-Amino(1,1'-biphenyl)-3-yl)amino)carbonyl)phenyl)methyl)carbamic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Methyl N-[[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate (CAS 1013330-79-4) is a chemical compound with the molecular formula C22H21N3O3 and a molecular weight of 375.4 g/mol. IUPAC name: methyl N-[[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate. InChIKey: QLRRIESOGZTMDR-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O3 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | methyl N-[[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate |
| InChIKey | QLRRIESOGZTMDR-UHFFFAOYSA-N |
| SMILES | COC(=O)NCC1=CC=C(C=C1)C(=O)NC2=C(C=CC(=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)