Products 620175-39-5
CAS 620175-39-5 appears in our catalog under these names: AFN–1252, AFN-1252/ 99.09% (existing batch purity), AFN-1252, AFN-1252, 98%, 98%, AFN-1252, 99.49%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide (CAS 620175-39-5) is a chemical compound with the molecular formula C22H21N3O3 and a molecular weight of 375.4 g/mol. IUPAC name: (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide. InChIKey: QXTWSUQCXCWEHF-JXMROGBWSA-N.
| Molecular formula | C22H21N3O3 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
| InChIKey | QXTWSUQCXCWEHF-JXMROGBWSA-N |
| SMILES | CC1=C(OC2=CC=CC=C12)CN(C)C(=O)/C=C/C3=CC4=C(NC(=O)CC4)N=C3 |
Computed by PubChem (NCBI)