Products 147404-75-9

CAS 147404-75-9 is the registry number for Azilsartan Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2-[[4-(2-carbamoylphenyl)phenyl]methylamino]benzoate (CAS 147404-75-9) is a chemical compound with the molecular formula C22H21N3O3 and a molecular weight of 375.4 g/mol. IUPAC name: methyl 3-amino-2-[[4-(2-carbamoylphenyl)phenyl]methylamino]benzoate. InChIKey: LTTPUFDSSLWLPU-UHFFFAOYSA-N.

Identity
Molecular formulaC22H21N3O3
Molecular weight375.4 g/mol
IUPAC namemethyl 3-amino-2-[[4-(2-carbamoylphenyl)phenyl]methylamino]benzoate
InChIKeyLTTPUFDSSLWLPU-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC=C1)N)NCC2=CC=C(C=C2)C3=CC=CC=C3C(=O)N

Computed by PubChem (NCBI)