CAS 147404-75-9 is the registry number for Azilsartan Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-2-[[4-(2-carbamoylphenyl)phenyl]methylamino]benzoate (CAS 147404-75-9) is a chemical compound with the molecular formula C22H21N3O3 and a molecular weight of 375.4 g/mol. IUPAC name: methyl 3-amino-2-[[4-(2-carbamoylphenyl)phenyl]methylamino]benzoate. InChIKey: LTTPUFDSSLWLPU-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O3 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | methyl 3-amino-2-[[4-(2-carbamoylphenyl)phenyl]methylamino]benzoate |
| InChIKey | LTTPUFDSSLWLPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)NCC2=CC=C(C=C2)C3=CC=CC=C3C(=O)N |
Computed by PubChem (NCBI)