Products 2415761-65-6
CAS 2415761-65-6 appears in our catalog under these names: Tubulin inhibitor 24/ 99.89% (existing batch purity), Tubulin inhibitor 24, Tubulin inhibitor 24, 99.94%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
2-(4-methylphenyl)-7-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine (CAS 2415761-65-6) is a chemical compound with the molecular formula C22H21N3O3 and a molecular weight of 375.4 g/mol. IUPAC name: 2-(4-methylphenyl)-7-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine. InChIKey: JSNTVTRKXKWPFD-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O3 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-(4-methylphenyl)-7-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine |
| InChIKey | JSNTVTRKXKWPFD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN3C(=CC=NC3=C2)C4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)