Products 101336-14-5

CAS 101336-14-5 is the registry number for 2-Amino-3-fluoro-5-nitrobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-3-fluoro-5-nitrobenzoic acid (CAS 101336-14-5) is a chemical compound with the molecular formula C7H5FN2O4 and a molecular weight of 200.12 g/mol. IUPAC name: 2-amino-3-fluoro-5-nitrobenzoic acid. InChIKey: QULHRHFQIGGDKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5FN2O4
Molecular weight200.12 g/mol
IUPAC name2-amino-3-fluoro-5-nitrobenzoic acid
InChIKeyQULHRHFQIGGDKQ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)N)F)[N+](=O)[O-]

Computed by PubChem (NCBI)