CAS 2384970-21-0 appears in our catalog under these names: 6-Fluoro-5-nitro-pyridine-2-carboxylic acid methyl ester, 95%, Methyl 6-fluoro-5-nitropicolinate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl 6-fluoro-5-nitropyridine-2-carboxylate (CAS 2384970-21-0) is a chemical compound with the molecular formula C7H5FN2O4 and a molecular weight of 200.12 g/mol. IUPAC name: methyl 6-fluoro-5-nitropyridine-2-carboxylate. InChIKey: PAZMALGMCIQIID-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O4 |
|---|---|
| Molecular weight | 200.12 g/mol |
| IUPAC name | methyl 6-fluoro-5-nitropyridine-2-carboxylate |
| InChIKey | PAZMALGMCIQIID-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)