CAS 177960-62-2 appears in our catalog under these names: 2-Amino-5-fluoro-3-nitrobenzoic acid, 95%, 2-Amino-5-fluoro-3-nitrobenzoic acid, 97%, 2-Amino-5-fluoro-3-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-amino-5-fluoro-3-nitrobenzoic acid (CAS 177960-62-2) is a chemical compound with the molecular formula C7H5FN2O4 and a molecular weight of 200.12 g/mol. IUPAC name: 2-amino-5-fluoro-3-nitrobenzoic acid. InChIKey: PJWWMVQRAZJKGT-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O4 |
|---|---|
| Molecular weight | 200.12 g/mol |
| IUPAC name | 2-amino-5-fluoro-3-nitrobenzoic acid |
| InChIKey | PJWWMVQRAZJKGT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)